C12H14F3N — CID 102756353
2-[2-methyl-4-(trifluoromethyl)phenyl]cyclobutan-1-amine (PubChem CID 102756353) has the molecular formula C12H14F3N and a molecular weight of 229.25 g/mol. Its IUPAC name is 2-[2-methyl-4-(trifluoromethyl)phenyl]cyclobutan-1-amine.
| Compound Name | 2-[2-methyl-4-(trifluoromethyl)phenyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 102756353 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-[2-methyl-4-(trifluoromethyl)phenyl]cyclobutan-1-amine |
| SMILES | Cc1cc(C(F)(F)F)ccc1C1CCC1N |
| InChI | InChI=1S/C12H14F3N/c1-7-6-8(12(13,14)15)2-3-9(7)10-4-5-11(10)16/h2-3,6,10-11H,4-5,16H2,1H3 |
| InChIKey | MSBPJWPHJZLQQJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |