C14H17ClF3NO2 — CID 140555403
2-[2-methyl-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 140555403) has the molecular formula C14H17ClF3NO2 and a molecular weight of 323.74 g/mol. Its IUPAC name is 2-[2-methyl-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 2-[2-methyl-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 140555403 |
| Molecular Formula | C14H17ClF3NO2 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-[2-methyl-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | Cc1cc(C(F)(F)F)ccc1C1CC(C(=O)O)CCN1.Cl |
| InChI | InChI=1S/C14H16F3NO2.ClH/c1-8-6-10(14(15,16)17)2-3-11(8)12-7-9(13(19)20)4-5-18-12;/h2-3,6,9,12,18H,4-5,7H2,1H3,(H,19,20);1H |
| InChIKey | DCBBGYGKSJEHBO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |