About 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride
2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 140555412) has the molecular formula C13H13ClF5NO2
and a molecular weight of 345.70 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride |
| PubChem CID | 140555412 |
| Molecular Formula | C13H13ClF5NO2 |
| Molecular Weight | 345.70 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1CCNC(c2cc(F)c(C(F)(F)F)c(F)c2)C1 |
| InChI | InChI=1S/C13H12F5NO2.ClH/c14-8-3-7(4-9(15)11(8)13(16,17)18)10-5-6(12(20)21)1-2-19-10;/h3-4,6,10,19H,1-2,5H2,(H,20,21);1H |
| InChIKey | ASOWXXFLZDHVGE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.70 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride?
The IUPAC name of 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride (CID 140555412) is 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride.
What is the SMILES notation for 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride?
The canonical SMILES for 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride is Cl.O=C(O)C1CCNC(c2cc(F)c(C(F)(F)F)c(F)c2)C1.
What is the InChIKey of 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride?
The InChIKey is ASOWXXFLZDHVGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F5NO2.ClH/c14-8-3-7(4-9(15)11(8)13(16,17)18)10-5-6(12(20)21)1-2-19-10;/h3-4,6,10,19H,1-2,5H2,(H,20,21);1H.
What are the key properties of 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride?
2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride has a molecular weight of 345.70 g/mol, XLogP of 3.53, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid;hydrochloride is sourced from PubChem (CID 140555412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).