C15H15NO4 — CID 175895947
2-(2-oxochromen-7-yl)piperidine-4-carboxylic acid (PubChem CID 175895947) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-(2-oxochromen-7-yl)piperidine-4-carboxylic acid.
| Compound Name | 2-(2-oxochromen-7-yl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 175895947 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-(2-oxochromen-7-yl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCNC(c2ccc3ccc(=O)oc3c2)C1 |
| InChI | InChI=1S/C15H15NO4/c17-14-4-3-9-1-2-10(8-13(9)20-14)12-7-11(15(18)19)5-6-16-12/h1-4,8,11-12,16H,5-7H2,(H,18,19) |
| InChIKey | CEBGFMJNOWCXBT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|