C13H13N3O4 — CID 117439869
5-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)pyrrolidine-3-carboxylic acid (PubChem CID 117439869) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is 5-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117439869 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 5-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CNC(c2ccc3[nH]c(=O)c(=O)[nH]c3c2)C1 |
| InChI | InChI=1S/C13H13N3O4/c17-11-12(18)16-10-3-6(1-2-8(10)15-11)9-4-7(5-14-9)13(19)20/h1-3,7,9,14H,4-5H2,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | IAEUUQRTFKIRSG-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|