C17H20N2O2 — CID 117457954
5-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)pyrrolidine-3-carboxylic acid (PubChem CID 117457954) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 5-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117457954 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 5-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CNC(c2ccc3[nH]c4c(c3c2)CCCC4)C1 |
| InChI | InChI=1S/C17H20N2O2/c20-17(21)11-8-16(18-9-11)10-5-6-15-13(7-10)12-3-1-2-4-14(12)19-15/h5-7,11,16,18-19H,1-4,8-9H2,(H,20,21) |
| InChIKey | AALBLPGWYNSWKY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|