About 3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine
3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine (PubChem CID 102758087) has the molecular formula C15H16Cl2FN3
and a molecular weight of 328.22 g/mol. Its IUPAC name is 3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine.
Molecular Properties
| Compound Name | 3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine |
| PubChem CID | 102758087 |
| Molecular Formula | C15H16Cl2FN3 |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine |
| SMILES | CNc1nc(NC(C)Cc2ccc(F)cc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H16Cl2FN3/c1-9(7-10-3-5-11(18)6-4-10)20-15-13(17)8-12(16)14(19-2)21-15/h3-6,8-9H,7H2,1-2H3,(H2,19,20,21) |
| InChIKey | RCRONFZKWGJVEV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine?
The IUPAC name of 3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine (CID 102758087) is 3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine.
What is the SMILES notation for 3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine?
The canonical SMILES for 3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine is CNc1nc(NC(C)Cc2ccc(F)cc2)c(Cl)cc1Cl.
What is the InChIKey of 3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine?
The InChIKey is RCRONFZKWGJVEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2FN3/c1-9(7-10-3-5-11(18)6-4-10)20-15-13(17)8-12(16)14(19-2)21-15/h3-6,8-9H,7H2,1-2H3,(H2,19,20,21).
What are the key properties of 3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine?
3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine has a molecular weight of 328.22 g/mol, XLogP of 4.61, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-6-N-[1-(4-fluorophenyl)propan-2-yl]-2-N-methylpyridine-2,6-diamine is sourced from PubChem (CID 102758087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).