C16H14ClFN2 — CID 63511677
2-chloro-4-[1-(4-fluorophenyl)propan-2-ylamino]benzonitrile (PubChem CID 63511677) has the molecular formula C16H14ClFN2 and a molecular weight of 288.75 g/mol. Its IUPAC name is 2-chloro-4-[1-(4-fluorophenyl)propan-2-ylamino]benzonitrile.
| Compound Name | 2-chloro-4-[1-(4-fluorophenyl)propan-2-ylamino]benzonitrile |
|---|---|
| PubChem CID | 63511677 |
| Molecular Formula | C16H14ClFN2 |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-chloro-4-[1-(4-fluorophenyl)propan-2-ylamino]benzonitrile |
| SMILES | CC(Cc1ccc(F)cc1)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C16H14ClFN2/c1-11(8-12-2-5-14(18)6-3-12)20-15-7-4-13(10-19)16(17)9-15/h2-7,9,11,20H,8H2,1H3 |
| InChIKey | RJYVVIQIDVESPW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |