C14H13ClN2S — CID 62946195
2-chloro-4-(1-thiophen-3-ylpropan-2-ylamino)benzonitrile (PubChem CID 62946195) has the molecular formula C14H13ClN2S and a molecular weight of 276.79 g/mol. Its IUPAC name is 2-chloro-4-(1-thiophen-3-ylpropan-2-ylamino)benzonitrile.
| Compound Name | 2-chloro-4-(1-thiophen-3-ylpropan-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 62946195 |
| Molecular Formula | C14H13ClN2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-chloro-4-(1-thiophen-3-ylpropan-2-ylamino)benzonitrile |
| SMILES | CC(Cc1ccsc1)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C14H13ClN2S/c1-10(6-11-4-5-18-9-11)17-13-3-2-12(8-16)14(15)7-13/h2-5,7,9-10,17H,6H2,1H3 |
| InChIKey | SAHCJEPPCZBBRO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |