About 1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol
1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol (PubChem CID 102758689) has the molecular formula C14H21Cl2N3O
and a molecular weight of 318.25 g/mol. Its IUPAC name is 1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol |
| PubChem CID | 102758689 |
| Molecular Formula | C14H21Cl2N3O |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol |
| SMILES | CNc1nc(NCC2(O)CCCC(C)C2)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H21Cl2N3O/c1-9-4-3-5-14(20,7-9)8-18-13-11(16)6-10(15)12(17-2)19-13/h6,9,20H,3-5,7-8H2,1-2H3,(H2,17,18,19) |
| InChIKey | HAOFLYFKISLDTF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol?
The IUPAC name of 1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol (CID 102758689) is 1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol.
What is the SMILES notation for 1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol?
The canonical SMILES for 1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol is CNc1nc(NCC2(O)CCCC(C)C2)c(Cl)cc1Cl.
What is the InChIKey of 1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol?
The InChIKey is HAOFLYFKISLDTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21Cl2N3O/c1-9-4-3-5-14(20,7-9)8-18-13-11(16)6-10(15)12(17-2)19-13/h6,9,20H,3-5,7-8H2,1-2H3,(H2,17,18,19).
What are the key properties of 1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol?
1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol has a molecular weight of 318.25 g/mol, XLogP of 3.78, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]methyl]-3-methylcyclohexan-1-ol is sourced from PubChem (CID 102758689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).