C12H18ClN3O — CID 63963822
1-[[(6-chloropyrazin-2-yl)amino]methyl]-3-methylcyclohexan-1-ol (PubChem CID 63963822) has the molecular formula C12H18ClN3O and a molecular weight of 255.75 g/mol. Its IUPAC name is 1-[[(6-chloropyrazin-2-yl)amino]methyl]-3-methylcyclohexan-1-ol.
| Compound Name | 1-[[(6-chloropyrazin-2-yl)amino]methyl]-3-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 63963822 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-[[(6-chloropyrazin-2-yl)amino]methyl]-3-methylcyclohexan-1-ol |
| SMILES | CC1CCCC(O)(CNc2cncc(Cl)n2)C1 |
| InChI | InChI=1S/C12H18ClN3O/c1-9-3-2-4-12(17,5-9)8-15-11-7-14-6-10(13)16-11/h6-7,9,17H,2-5,8H2,1H3,(H,15,16) |
| InChIKey | GWYXEXQRYLZOSP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |