C13H20N4O2 — CID 79098492
6-[(1-hydroxy-3-methylcyclohexyl)methylamino]pyridazine-3-carboxamide (PubChem CID 79098492) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 6-[(1-hydroxy-3-methylcyclohexyl)methylamino]pyridazine-3-carboxamide.
| Compound Name | 6-[(1-hydroxy-3-methylcyclohexyl)methylamino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 79098492 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 6-[(1-hydroxy-3-methylcyclohexyl)methylamino]pyridazine-3-carboxamide |
| SMILES | CC1CCCC(O)(CNc2ccc(C(N)=O)nn2)C1 |
| InChI | InChI=1S/C13H20N4O2/c1-9-3-2-6-13(19,7-9)8-15-11-5-4-10(12(14)18)16-17-11/h4-5,9,19H,2-3,6-8H2,1H3,(H2,14,18)(H,15,17) |
| InChIKey | ZVYROEFDHXBLPJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |