C10H15N5O — CID 103354254
6-[(1-aminocyclobutyl)methylamino]pyridazine-3-carboxamide (PubChem CID 103354254) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is 6-[(1-aminocyclobutyl)methylamino]pyridazine-3-carboxamide.
| Compound Name | 6-[(1-aminocyclobutyl)methylamino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103354254 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 6-[(1-aminocyclobutyl)methylamino]pyridazine-3-carboxamide |
| SMILES | NC(=O)c1ccc(NCC2(N)CCC2)nn1 |
| InChI | InChI=1S/C10H15N5O/c11-9(16)7-2-3-8(15-14-7)13-6-10(12)4-1-5-10/h2-3H,1,4-6,12H2,(H2,11,16)(H,13,15) |
| InChIKey | WNKREHWKJAWLIR-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |