C12H17F3N2O2S — CID 102760037
[2-methylsulfonyl-1-[2-methyl-4-(trifluoromethyl)phenyl]propyl]hydrazine (PubChem CID 102760037) has the molecular formula C12H17F3N2O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is [2-methylsulfonyl-1-[2-methyl-4-(trifluoromethyl)phenyl]propyl]hydrazine.
| Compound Name | [2-methylsulfonyl-1-[2-methyl-4-(trifluoromethyl)phenyl]propyl]hydrazine |
|---|---|
| PubChem CID | 102760037 |
| Molecular Formula | C12H17F3N2O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | [2-methylsulfonyl-1-[2-methyl-4-(trifluoromethyl)phenyl]propyl]hydrazine |
| SMILES | Cc1cc(C(F)(F)F)ccc1C(NN)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C12H17F3N2O2S/c1-7-6-9(12(13,14)15)4-5-10(7)11(17-16)8(2)20(3,18)19/h4-6,8,11,17H,16H2,1-3H3 |
| InChIKey | YWCVFUBAZOSBLW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|