C11H6Cl2F2N2O — CID 102760964
3,5-dichloro-6-(2,5-difluorophenoxy)pyridin-2-amine (PubChem CID 102760964) has the molecular formula C11H6Cl2F2N2O and a molecular weight of 291.08 g/mol. Its IUPAC name is 3,5-dichloro-6-(2,5-difluorophenoxy)pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(2,5-difluorophenoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 102760964 |
| Molecular Formula | C11H6Cl2F2N2O |
| Molecular Weight | 291.08 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 3,5-dichloro-6-(2,5-difluorophenoxy)pyridin-2-amine |
| SMILES | Nc1nc(Oc2cc(F)ccc2F)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H6Cl2F2N2O/c12-6-4-7(13)11(17-10(6)16)18-9-3-5(14)1-2-8(9)15/h1-4H,(H2,16,17) |
| InChIKey | RALLGOOYINQSKL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.08 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |