C13H11Cl2N3O3 — CID 102760998
3,5-dichloro-6-(4-ethyl-2-nitrophenoxy)pyridin-2-amine (PubChem CID 102760998) has the molecular formula C13H11Cl2N3O3 and a molecular weight of 328.16 g/mol. Its IUPAC name is 3,5-dichloro-6-(4-ethyl-2-nitrophenoxy)pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(4-ethyl-2-nitrophenoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 102760998 |
| Molecular Formula | C13H11Cl2N3O3 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 3,5-dichloro-6-(4-ethyl-2-nitrophenoxy)pyridin-2-amine |
| SMILES | CCc1ccc(Oc2nc(N)c(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11Cl2N3O3/c1-2-7-3-4-11(10(5-7)18(19)20)21-13-9(15)6-8(14)12(16)17-13/h3-6H,2H2,1H3,(H2,16,17) |
| InChIKey | BNURYTSZTFSWBX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|