C12H18Cl2N4O — CID 102761741
3,5-dichloro-6-hydrazinyl-N-methyl-N-(oxan-2-ylmethyl)pyridin-2-amine (PubChem CID 102761741) has the molecular formula C12H18Cl2N4O and a molecular weight of 305.21 g/mol. Its IUPAC name is 3,5-dichloro-6-hydrazinyl-N-methyl-N-(oxan-2-ylmethyl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-hydrazinyl-N-methyl-N-(oxan-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102761741 |
| Molecular Formula | C12H18Cl2N4O |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 3,5-dichloro-6-hydrazinyl-N-methyl-N-(oxan-2-ylmethyl)pyridin-2-amine |
| SMILES | CN(CC1CCCCO1)c1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H18Cl2N4O/c1-18(7-8-4-2-3-5-19-8)12-10(14)6-9(13)11(16-12)17-15/h6,8H,2-5,7,15H2,1H3,(H,16,17) |
| InChIKey | KKZFKYUBGLEWFN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|