C14H15Cl2NS — CID 102763666
1-(3-chloro-5-methylphenyl)-1-(5-chloro-4-methylthiophen-2-yl)-N-methylmethanamine (PubChem CID 102763666) has the molecular formula C14H15Cl2NS and a molecular weight of 300.25 g/mol. Its IUPAC name is 1-(3-chloro-5-methylphenyl)-1-(5-chloro-4-methylthiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(3-chloro-5-methylphenyl)-1-(5-chloro-4-methylthiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 102763666 |
| Molecular Formula | C14H15Cl2NS |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 1-(3-chloro-5-methylphenyl)-1-(5-chloro-4-methylthiophen-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc(C)cc(Cl)c1)c1cc(C)c(Cl)s1 |
| InChI | InChI=1S/C14H15Cl2NS/c1-8-4-10(7-11(15)5-8)13(17-3)12-6-9(2)14(16)18-12/h4-7,13,17H,1-3H3 |
| InChIKey | BVXSDXBBVSPRRB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |