C13H12Br2ClNS — CID 107950722
1-(3-bromo-5-chlorophenyl)-1-(5-bromo-4-methylthiophen-2-yl)-N-methylmethanamine (PubChem CID 107950722) has the molecular formula C13H12Br2ClNS and a molecular weight of 409.57 g/mol. Its IUPAC name is 1-(3-bromo-5-chlorophenyl)-1-(5-bromo-4-methylthiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(3-bromo-5-chlorophenyl)-1-(5-bromo-4-methylthiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107950722 |
| Molecular Formula | C13H12Br2ClNS |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 406.87 |
| IUPAC Name | 1-(3-bromo-5-chlorophenyl)-1-(5-bromo-4-methylthiophen-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc(Cl)cc(Br)c1)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C13H12Br2ClNS/c1-7-3-11(18-13(7)15)12(17-2)8-4-9(14)6-10(16)5-8/h3-6,12,17H,1-2H3 |
| InChIKey | GPQNZYKMYFMFKK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |