C12H13Br2NS2 — CID 79981226
1-(3-bromo-5-methylthiophen-2-yl)-1-(5-bromo-4-methylthiophen-2-yl)-N-methylmethanamine (PubChem CID 79981226) has the molecular formula C12H13Br2NS2 and a molecular weight of 395.19 g/mol. Its IUPAC name is 1-(3-bromo-5-methylthiophen-2-yl)-1-(5-bromo-4-methylthiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(3-bromo-5-methylthiophen-2-yl)-1-(5-bromo-4-methylthiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 79981226 |
| Molecular Formula | C12H13Br2NS2 |
| Molecular Weight | 395.19 g/mol |
| Exact Mass | 392.89 |
| IUPAC Name | 1-(3-bromo-5-methylthiophen-2-yl)-1-(5-bromo-4-methylthiophen-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc(C)c(Br)s1)c1sc(C)cc1Br |
| InChI | InChI=1S/C12H13Br2NS2/c1-6-4-9(17-12(6)14)10(15-3)11-8(13)5-7(2)16-11/h4-5,10,15H,1-3H3 |
| InChIKey | WMXMPVYXFSYTEJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.19 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |