C13H12Br2INS — CID 114027607
1-(2-bromo-5-iodophenyl)-1-(5-bromo-4-methylthiophen-2-yl)-N-methylmethanamine (PubChem CID 114027607) has the molecular formula C13H12Br2INS and a molecular weight of 501.03 g/mol. Its IUPAC name is 1-(2-bromo-5-iodophenyl)-1-(5-bromo-4-methylthiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(2-bromo-5-iodophenyl)-1-(5-bromo-4-methylthiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 114027607 |
| Molecular Formula | C13H12Br2INS |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 498.81 |
| IUPAC Name | 1-(2-bromo-5-iodophenyl)-1-(5-bromo-4-methylthiophen-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc(C)c(Br)s1)c1cc(I)ccc1Br |
| InChI | InChI=1S/C13H12Br2INS/c1-7-5-11(18-13(7)15)12(17-2)9-6-8(16)3-4-10(9)14/h3-6,12,17H,1-2H3 |
| InChIKey | UWMSIKQVDJMZCA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|