C14H15BrClNS — CID 114027955
1-(5-bromo-4-methylthiophen-2-yl)-1-(4-chloro-2-methylphenyl)-N-methylmethanamine (PubChem CID 114027955) has the molecular formula C14H15BrClNS and a molecular weight of 344.71 g/mol. Its IUPAC name is 1-(5-bromo-4-methylthiophen-2-yl)-1-(4-chloro-2-methylphenyl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-4-methylthiophen-2-yl)-1-(4-chloro-2-methylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 114027955 |
| Molecular Formula | C14H15BrClNS |
| Molecular Weight | 344.71 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 1-(5-bromo-4-methylthiophen-2-yl)-1-(4-chloro-2-methylphenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc(C)c(Br)s1)c1ccc(Cl)cc1C |
| InChI | InChI=1S/C14H15BrClNS/c1-8-6-10(16)4-5-11(8)13(17-3)12-7-9(2)14(15)18-12/h4-7,13,17H,1-3H3 |
| InChIKey | VZOQMQKAFLZKSO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.71 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |