C15H18ClNS — CID 102763744
1-(5-chloro-4-methylthiophen-2-yl)-1-(2-ethylphenyl)-N-methylmethanamine (PubChem CID 102763744) has the molecular formula C15H18ClNS and a molecular weight of 279.84 g/mol. Its IUPAC name is 1-(5-chloro-4-methylthiophen-2-yl)-1-(2-ethylphenyl)-N-methylmethanamine.
| Compound Name | 1-(5-chloro-4-methylthiophen-2-yl)-1-(2-ethylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 102763744 |
| Molecular Formula | C15H18ClNS |
| Molecular Weight | 279.84 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 1-(5-chloro-4-methylthiophen-2-yl)-1-(2-ethylphenyl)-N-methylmethanamine |
| SMILES | CCc1ccccc1C(NC)c1cc(C)c(Cl)s1 |
| InChI | InChI=1S/C15H18ClNS/c1-4-11-7-5-6-8-12(11)14(17-3)13-9-10(2)15(16)18-13/h5-9,14,17H,4H2,1-3H3 |
| InChIKey | JKYXGDPSBREGSS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.84 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |