C13H22ClNOS — CID 102765218
N-[2-[2-(5-chloro-4-methylthiophen-2-yl)ethoxy]ethyl]-2-methylpropan-1-amine (PubChem CID 102765218) has the molecular formula C13H22ClNOS and a molecular weight of 275.84 g/mol. Its IUPAC name is N-[2-[2-(5-chloro-4-methylthiophen-2-yl)ethoxy]ethyl]-2-methylpropan-1-amine.
| Compound Name | N-[2-[2-(5-chloro-4-methylthiophen-2-yl)ethoxy]ethyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 102765218 |
| Molecular Formula | C13H22ClNOS |
| Molecular Weight | 275.84 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-[2-[2-(5-chloro-4-methylthiophen-2-yl)ethoxy]ethyl]-2-methylpropan-1-amine |
| SMILES | Cc1cc(CCOCCNCC(C)C)sc1Cl |
| InChI | InChI=1S/C13H22ClNOS/c1-10(2)9-15-5-7-16-6-4-12-8-11(3)13(14)17-12/h8,10,15H,4-7,9H2,1-3H3 |
| InChIKey | DVGULNFBMUEDTB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.84 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|