C19H33NO — CID 65303494
2-methyl-N-[2-[2-(2,3,4,5,6-pentamethylphenyl)ethoxy]ethyl]propan-1-amine (PubChem CID 65303494) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-(2,3,4,5,6-pentamethylphenyl)ethoxy]ethyl]propan-1-amine.
| Compound Name | 2-methyl-N-[2-[2-(2,3,4,5,6-pentamethylphenyl)ethoxy]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 65303494 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 2-methyl-N-[2-[2-(2,3,4,5,6-pentamethylphenyl)ethoxy]ethyl]propan-1-amine |
| SMILES | Cc1c(C)c(C)c(CCOCCNCC(C)C)c(C)c1C |
| InChI | InChI=1S/C19H33NO/c1-13(2)12-20-9-11-21-10-8-19-17(6)15(4)14(3)16(5)18(19)7/h13,20H,8-12H2,1-7H3 |
| InChIKey | FZFVBDKKORJECH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|