C12H9BrN2O4 — CID 102766019
3-bromo-4-[(3,6-dioxo-1H-pyridazin-2-yl)methyl]benzoic acid (PubChem CID 102766019) has the molecular formula C12H9BrN2O4 and a molecular weight of 325.12 g/mol. Its IUPAC name is 3-bromo-4-[(3,6-dioxo-1H-pyridazin-2-yl)methyl]benzoic acid.
| Compound Name | 3-bromo-4-[(3,6-dioxo-1H-pyridazin-2-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 102766019 |
| Molecular Formula | C12H9BrN2O4 |
| Molecular Weight | 325.12 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 3-bromo-4-[(3,6-dioxo-1H-pyridazin-2-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cn2[nH]c(=O)ccc2=O)c(Br)c1 |
| InChI | InChI=1S/C12H9BrN2O4/c13-9-5-7(12(18)19)1-2-8(9)6-15-11(17)4-3-10(16)14-15/h1-5H,6H2,(H,14,16)(H,18,19) |
| InChIKey | LSGYRPXUCGTOFY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.12 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |