About 3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid
3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid (PubChem CID 102766198) has the molecular formula C15H16BrNO4
and a molecular weight of 354.20 g/mol. Its IUPAC name is 3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid.
Molecular Properties
| Compound Name | 3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid |
| PubChem CID | 102766198 |
| Molecular Formula | C15H16BrNO4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid |
| SMILES | CC1(C)CC(=O)N(Cc2ccc(C(=O)O)cc2Br)C(=O)C1 |
| InChI | InChI=1S/C15H16BrNO4/c1-15(2)6-12(18)17(13(19)7-15)8-10-4-3-9(14(20)21)5-11(10)16/h3-5H,6-8H2,1-2H3,(H,20,21) |
| InChIKey | NZOJGIJGOLSDCE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid?
The IUPAC name of 3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid (CID 102766198) is 3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid.
What is the SMILES notation for 3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid?
The canonical SMILES for 3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid is CC1(C)CC(=O)N(Cc2ccc(C(=O)O)cc2Br)C(=O)C1.
What is the InChIKey of 3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid?
The InChIKey is NZOJGIJGOLSDCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16BrNO4/c1-15(2)6-12(18)17(13(19)7-15)8-10-4-3-9(14(20)21)5-11(10)16/h3-5H,6-8H2,1-2H3,(H,20,21).
What are the key properties of 3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid?
3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid has a molecular weight of 354.20 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-[(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl]benzoic acid is sourced from PubChem (CID 102766198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).