C16H22BrNO3 — CID 102768228
3-bromo-4-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]benzoic acid (PubChem CID 102768228) has the molecular formula C16H22BrNO3 and a molecular weight of 356.26 g/mol. Its IUPAC name is 3-bromo-4-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]benzoic acid.
| Compound Name | 3-bromo-4-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 102768228 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 3-bromo-4-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]benzoic acid |
| SMILES | CC1(C)CN(Cc2ccc(C(=O)O)cc2Br)CC(C)(C)O1 |
| InChI | InChI=1S/C16H22BrNO3/c1-15(2)9-18(10-16(3,4)21-15)8-12-6-5-11(14(19)20)7-13(12)17/h5-7H,8-10H2,1-4H3,(H,19,20) |
| InChIKey | RPIIZWQFYUACTH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |