C10H17N3S — CID 102767119
2-N-cyclohexyl-2-N-methyl-1,3-thiazole-2,5-diamine (PubChem CID 102767119) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 2-N-cyclohexyl-2-N-methyl-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-cyclohexyl-2-N-methyl-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 102767119 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-N-cyclohexyl-2-N-methyl-1,3-thiazole-2,5-diamine |
| SMILES | CN(c1ncc(N)s1)C1CCCCC1 |
| InChI | InChI=1S/C10H17N3S/c1-13(8-5-3-2-4-6-8)10-12-7-9(11)14-10/h7-8H,2-6,11H2,1H3 |
| InChIKey | QWUHLDLOHMRXPA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |