C10H16N2O2S — CID 62752479
[2-[methyl(oxan-4-yl)amino]-1,3-thiazol-5-yl]methanol (PubChem CID 62752479) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is [2-[methyl(oxan-4-yl)amino]-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-[methyl(oxan-4-yl)amino]-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 62752479 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | [2-[methyl(oxan-4-yl)amino]-1,3-thiazol-5-yl]methanol |
| SMILES | CN(c1ncc(CO)s1)C1CCOCC1 |
| InChI | InChI=1S/C10H16N2O2S/c1-12(8-2-4-14-5-3-8)10-11-6-9(7-13)15-10/h6,8,13H,2-5,7H2,1H3 |
| InChIKey | JFNLNTGSFHGDJR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |