C9H15N3OS — CID 102769455
2-(1-methylpiperidin-4-yl)oxy-1,3-thiazol-5-amine (PubChem CID 102769455) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-(1-methylpiperidin-4-yl)oxy-1,3-thiazol-5-amine.
| Compound Name | 2-(1-methylpiperidin-4-yl)oxy-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 102769455 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-(1-methylpiperidin-4-yl)oxy-1,3-thiazol-5-amine |
| SMILES | CN1CCC(Oc2ncc(N)s2)CC1 |
| InChI | InChI=1S/C9H15N3OS/c1-12-4-2-7(3-5-12)13-9-11-6-8(10)14-9/h6-7H,2-5,10H2,1H3 |
| InChIKey | ZPFKCXKBAKHUNU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |