C11H15F2N3O — CID 114073369
3,5-difluoro-6-(1-methylpiperidin-4-yl)oxypyridin-2-amine (PubChem CID 114073369) has the molecular formula C11H15F2N3O and a molecular weight of 243.26 g/mol. Its IUPAC name is 3,5-difluoro-6-(1-methylpiperidin-4-yl)oxypyridin-2-amine.
| Compound Name | 3,5-difluoro-6-(1-methylpiperidin-4-yl)oxypyridin-2-amine |
|---|---|
| PubChem CID | 114073369 |
| Molecular Formula | C11H15F2N3O |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3,5-difluoro-6-(1-methylpiperidin-4-yl)oxypyridin-2-amine |
| SMILES | CN1CCC(Oc2nc(N)c(F)cc2F)CC1 |
| InChI | InChI=1S/C11H15F2N3O/c1-16-4-2-7(3-5-16)17-11-9(13)6-8(12)10(14)15-11/h6-7H,2-5H2,1H3,(H2,14,15) |
| InChIKey | YRWOTXRHVGWGPA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |