C12H20N2O — CID 174368806
5-(1-methylpiperidin-4-yl)oxycyclohexa-1,5-dien-1-amine (PubChem CID 174368806) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 5-(1-methylpiperidin-4-yl)oxycyclohexa-1,5-dien-1-amine.
| Compound Name | 5-(1-methylpiperidin-4-yl)oxycyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 174368806 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 5-(1-methylpiperidin-4-yl)oxycyclohexa-1,5-dien-1-amine |
| SMILES | CN1CCC(OC2=CC(N)=CCC2)CC1 |
| InChI | InChI=1S/C12H20N2O/c1-14-7-5-11(6-8-14)15-12-4-2-3-10(13)9-12/h3,9,11H,2,4-8,13H2,1H3 |
| InChIKey | IDMVTJXELWPQRK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |