C12H20N2O — CID 155215851
4-(1,5-dimethylpyrrol-2-yl)oxy-1-methylpiperidine (PubChem CID 155215851) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-(1,5-dimethylpyrrol-2-yl)oxy-1-methylpiperidine.
| Compound Name | 4-(1,5-dimethylpyrrol-2-yl)oxy-1-methylpiperidine |
|---|---|
| PubChem CID | 155215851 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 4-(1,5-dimethylpyrrol-2-yl)oxy-1-methylpiperidine |
| SMILES | Cc1ccc(OC2CCN(C)CC2)n1C |
| InChI | InChI=1S/C12H20N2O/c1-10-4-5-12(14(10)3)15-11-6-8-13(2)9-7-11/h4-5,11H,6-9H2,1-3H3 |
| InChIKey | OZLKOFOFFCKDAM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |