About 3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile
3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile (PubChem CID 102769609) has the molecular formula C12H7N3O2S
and a molecular weight of 257.27 g/mol. Its IUPAC name is 3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile.
Molecular Properties
| Compound Name | 3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile |
| PubChem CID | 102769609 |
| Molecular Formula | C12H7N3O2S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile |
| SMILES | N#Cc1oc2ccccc2c1Oc1ncc(N)s1 |
| InChI | InChI=1S/C12H7N3O2S/c13-5-9-11(17-12-15-6-10(14)18-12)7-3-1-2-4-8(7)16-9/h1-4,6H,14H2 |
| InChIKey | YKYYMXYXIBFALQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile?
The IUPAC name of 3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile (CID 102769609) is 3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile.
What is the SMILES notation for 3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile?
The canonical SMILES for 3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile is N#Cc1oc2ccccc2c1Oc1ncc(N)s1.
What is the InChIKey of 3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile?
The InChIKey is YKYYMXYXIBFALQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O2S/c13-5-9-11(17-12-15-6-10(14)18-12)7-3-1-2-4-8(7)16-9/h1-4,6H,14H2.
What are the key properties of 3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile?
3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile has a molecular weight of 257.27 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-amino-1,3-thiazol-2-yl)oxy]-1-benzofuran-2-carbonitrile is sourced from PubChem (CID 102769609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).