C6H8N2O2S2 — CID 102770260
methyl 2-[(5-amino-1,3-thiazol-2-yl)sulfanyl]acetate (PubChem CID 102770260) has the molecular formula C6H8N2O2S2 and a molecular weight of 204.28 g/mol. Its IUPAC name is methyl 2-[(5-amino-1,3-thiazol-2-yl)sulfanyl]acetate.
| Compound Name | methyl 2-[(5-amino-1,3-thiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 102770260 |
| Molecular Formula | C6H8N2O2S2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | methyl 2-[(5-amino-1,3-thiazol-2-yl)sulfanyl]acetate |
| SMILES | COC(=O)CSc1ncc(N)s1 |
| InChI | InChI=1S/C6H8N2O2S2/c1-10-5(9)3-11-6-8-2-4(7)12-6/h2H,3,7H2,1H3 |
| InChIKey | YPQXYDOLWIVRHG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|