C13H15N3O3S — CID 102771888
N-benzyl-3-[(5-nitro-1,3-thiazol-2-yl)oxy]propan-1-amine (PubChem CID 102771888) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is N-benzyl-3-[(5-nitro-1,3-thiazol-2-yl)oxy]propan-1-amine.
| Compound Name | N-benzyl-3-[(5-nitro-1,3-thiazol-2-yl)oxy]propan-1-amine |
|---|---|
| PubChem CID | 102771888 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-benzyl-3-[(5-nitro-1,3-thiazol-2-yl)oxy]propan-1-amine |
| SMILES | O=[N+]([O-])c1cnc(OCCCNCc2ccccc2)s1 |
| InChI | InChI=1S/C13H15N3O3S/c17-16(18)12-10-15-13(20-12)19-8-4-7-14-9-11-5-2-1-3-6-11/h1-3,5-6,10,14H,4,7-9H2 |
| InChIKey | VSQXWMSQQQLQNH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|