C12H15N3OS — CID 114783212
N-benzyl-3-(1,3,4-thiadiazol-2-yloxy)propan-1-amine (PubChem CID 114783212) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is N-benzyl-3-(1,3,4-thiadiazol-2-yloxy)propan-1-amine.
| Compound Name | N-benzyl-3-(1,3,4-thiadiazol-2-yloxy)propan-1-amine |
|---|---|
| PubChem CID | 114783212 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | N-benzyl-3-(1,3,4-thiadiazol-2-yloxy)propan-1-amine |
| SMILES | c1ccc(CNCCCOc2nncs2)cc1 |
| InChI | InChI=1S/C12H15N3OS/c1-2-5-11(6-3-1)9-13-7-4-8-16-12-15-14-10-17-12/h1-3,5-6,10,13H,4,7-9H2 |
| InChIKey | CGKRMYALUPKNIG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|