C23H23Cl2N3O2S — CID 10277214
N-[1-[bis(4-chlorophenyl)methyl]azetidin-3-yl]-N-(pyridin-3-ylmethyl)methanesulfonamide (PubChem CID 10277214) has the molecular formula C23H23Cl2N3O2S and a molecular weight of 476.43 g/mol. Its IUPAC name is N-[1-[bis(4-chlorophenyl)methyl]azetidin-3-yl]-N-(pyridin-3-ylmethyl)methanesulfonamide.
| Compound Name | N-[1-[bis(4-chlorophenyl)methyl]azetidin-3-yl]-N-(pyridin-3-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 10277214 |
| Molecular Formula | C23H23Cl2N3O2S |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[1-[bis(4-chlorophenyl)methyl]azetidin-3-yl]-N-(pyridin-3-ylmethyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1cccnc1)C1CN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C23H23Cl2N3O2S/c1-31(29,30)28(14-17-3-2-12-26-13-17)22-15-27(16-22)23(18-4-8-20(24)9-5-18)19-6-10-21(25)11-7-19/h2-13,22-23H,14-16H2,1H3 |
| InChIKey | VLNAPZURJYOPBL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |