C26H23Cl2N3O2S — CID 21097950
5-[[[1-[bis(4-chlorophenyl)methyl]azetidin-3-yl]-sulfinoamino]methyl]quinoline (PubChem CID 21097950) has the molecular formula C26H23Cl2N3O2S and a molecular weight of 512.46 g/mol. Its IUPAC name is 5-[[[1-[bis(4-chlorophenyl)methyl]azetidin-3-yl]-sulfinoamino]methyl]quinoline.
| Compound Name | 5-[[[1-[bis(4-chlorophenyl)methyl]azetidin-3-yl]-sulfinoamino]methyl]quinoline |
|---|---|
| PubChem CID | 21097950 |
| Molecular Formula | C26H23Cl2N3O2S |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 5-[[[1-[bis(4-chlorophenyl)methyl]azetidin-3-yl]-sulfinoamino]methyl]quinoline |
| SMILES | O=S(O)N(Cc1cccc2ncccc12)C1CN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C26H23Cl2N3O2S/c27-21-10-6-18(7-11-21)26(19-8-12-22(28)13-9-19)30-16-23(17-30)31(34(32)33)15-20-3-1-5-25-24(20)4-2-14-29-25/h1-14,23,26H,15-17H2,(H,32,33) |
| InChIKey | XXQBBOPICYYGIQ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|