C10H18N2O3 — CID 102778052
methyl (2S)-2-[(3-methylpyrrolidine-2-carbonyl)amino]propanoate (PubChem CID 102778052) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is methyl (2S)-2-[(3-methylpyrrolidine-2-carbonyl)amino]propanoate.
| Compound Name | methyl (2S)-2-[(3-methylpyrrolidine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 102778052 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | methyl (2S)-2-[(3-methylpyrrolidine-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)C1NCCC1C |
| InChI | InChI=1S/C10H18N2O3/c1-6-4-5-11-8(6)9(13)12-7(2)10(14)15-3/h6-8,11H,4-5H2,1-3H3,(H,12,13)/t6?,7-,8?/m0/s1 |
| InChIKey | KISAGUBDTJAFKJ-WTIBDHCWSA-N |
| XLogP | -0.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |