C23H24FN5O4S — CID 10277810
2-[3-(benzylsulfonylamino)-6-methyl-2-oxo-1-pyridinyl]-N-[(4-carbamimidoyl-3-fluorophenyl)methyl]acetamide (PubChem CID 10277810) has the molecular formula C23H24FN5O4S and a molecular weight of 485.54 g/mol. Its IUPAC name is 2-[3-(benzylsulfonylamino)-6-methyl-2-oxo-1-pyridinyl]-N-[(4-carbamimidoyl-3-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[3-(benzylsulfonylamino)-6-methyl-2-oxo-1-pyridinyl]-N-[(4-carbamimidoyl-3-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 10277810 |
| Molecular Formula | C23H24FN5O4S |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 2-[3-(benzylsulfonylamino)-6-methyl-2-oxo-1-pyridinyl]-N-[(4-carbamimidoyl-3-fluorophenyl)methyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2c(C)ccc(NS(=O)(=O)Cc3ccccc3)c2=O)cc1F |
| InChI | InChI=1S/C23H24FN5O4S/c1-15-7-10-20(28-34(32,33)14-16-5-3-2-4-6-16)23(31)29(15)13-21(30)27-12-17-8-9-18(22(25)26)19(24)11-17/h2-11,28H,12-14H2,1H3,(H3,25,26)(H,27,30) |
| InChIKey | MUCFNOZSTPFMCD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 147.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|