C29H36F3NO2 — CID 10277929
(6S,10R,13S,17S)-6-ethyl-10,13-dimethyl-3-oxo-N-[4-(trifluoromethyl)phenyl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 10277929) has the molecular formula C29H36F3NO2 and a molecular weight of 487.61 g/mol. Its IUPAC name is (6S,10R,13S,17S)-6-ethyl-10,13-dimethyl-3-oxo-N-[4-(trifluoromethyl)phenyl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (6S,10R,13S,17S)-6-ethyl-10,13-dimethyl-3-oxo-N-[4-(trifluoromethyl)phenyl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 10277929 |
| Molecular Formula | C29H36F3NO2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | (6S,10R,13S,17S)-6-ethyl-10,13-dimethyl-3-oxo-N-[4-(trifluoromethyl)phenyl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CC[C@H]1CC2C(CC[C@@]3(C)C2CC[C@@H]3C(=O)Nc2ccc(C(F)(F)F)cc2)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C29H36F3NO2/c1-4-17-15-21-22-9-10-24(26(35)33-19-7-5-18(6-8-19)29(30,31)32)27(22,2)14-12-23(21)28(3)13-11-20(34)16-25(17)28/h5-8,16-17,21-24H,4,9-15H2,1-3H3,(H,33,35)/t17-,21?,22?,23?,24+,27-,28+/m0/s1 |
| InChIKey | YKTKWXFJBSPSNL-SIHQPKNYSA-N |
| XLogP | 7.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |