C32H36N2O3 — CID 176941740
(9aR,11aS)-N-(4-benzoylphenyl)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridine-1-carboxamide (PubChem CID 176941740) has the molecular formula C32H36N2O3 and a molecular weight of 496.65 g/mol. Its IUPAC name is (9aR,11aS)-N-(4-benzoylphenyl)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridine-1-carboxamide.
| Compound Name | (9aR,11aS)-N-(4-benzoylphenyl)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridine-1-carboxamide |
|---|---|
| PubChem CID | 176941740 |
| Molecular Formula | C32H36N2O3 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | (9aR,11aS)-N-(4-benzoylphenyl)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridine-1-carboxamide |
| SMILES | C[C@]12CCC3C(CNC4=CC(=O)CC[C@@]43C)C1CCC2C(=O)Nc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H36N2O3/c1-31-17-15-26-24(19-33-28-18-23(35)14-16-32(26,28)2)25(31)12-13-27(31)30(37)34-22-10-8-21(9-11-22)29(36)20-6-4-3-5-7-20/h3-11,18,24-27,33H,12-17,19H2,1-2H3,(H,34,37)/t24?,25?,26?,27?,31-,32+/m0/s1 |
| InChIKey | QNDHTRKKUKJKPP-DLQOBOHJSA-N |
| XLogP | 5.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |