C14H26N2O — CID 102779573
N-(3,5-dimethylcyclohexyl)-3-methylpyrrolidine-2-carboxamide (PubChem CID 102779573) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexyl)-3-methylpyrrolidine-2-carboxamide.
| Compound Name | N-(3,5-dimethylcyclohexyl)-3-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 102779573 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | N-(3,5-dimethylcyclohexyl)-3-methylpyrrolidine-2-carboxamide |
| SMILES | CC1CC(C)CC(NC(=O)C2NCCC2C)C1 |
| InChI | InChI=1S/C14H26N2O/c1-9-6-10(2)8-12(7-9)16-14(17)13-11(3)4-5-15-13/h9-13,15H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | MPPQTWCFZNYXBG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |