C12H22N2O — CID 120633929
(2S,4S)-2-methyl-N-(3-methylcyclobutyl)piperidine-4-carboxamide (PubChem CID 120633929) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (2S,4S)-2-methyl-N-(3-methylcyclobutyl)piperidine-4-carboxamide.
| Compound Name | (2S,4S)-2-methyl-N-(3-methylcyclobutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120633929 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (2S,4S)-2-methyl-N-(3-methylcyclobutyl)piperidine-4-carboxamide |
| SMILES | CC1CC(NC(=O)[C@H]2CCN[C@@H](C)C2)C1 |
| InChI | InChI=1S/C12H22N2O/c1-8-5-11(6-8)14-12(15)10-3-4-13-9(2)7-10/h8-11,13H,3-7H2,1-2H3,(H,14,15)/t8?,9-,10-,11?/m0/s1 |
| InChIKey | NHDKYOUVDHZLKJ-SEQHWMEXSA-N |
| XLogP | 1.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |