C14H25N3O2 — CID 120628042
(2S,4S)-N-(3-carbamoylcyclohexyl)-2-methylpiperidine-4-carboxamide (PubChem CID 120628042) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is (2S,4S)-N-(3-carbamoylcyclohexyl)-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-(3-carbamoylcyclohexyl)-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120628042 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | (2S,4S)-N-(3-carbamoylcyclohexyl)-2-methylpiperidine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(=O)NC2CCCC(C(N)=O)C2)CCN1 |
| InChI | InChI=1S/C14H25N3O2/c1-9-7-11(5-6-16-9)14(19)17-12-4-2-3-10(8-12)13(15)18/h9-12,16H,2-8H2,1H3,(H2,15,18)(H,17,19)/t9-,10?,11-,12?/m0/s1 |
| InChIKey | TXGVVJXJDSDICL-VOBJUBJWSA-N |
| XLogP | 0.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |