C8H14N2O3 — CID 68629698
[(1S,3S)-3-carbamoylcyclohexyl]carbamic acid (PubChem CID 68629698) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is [(1S,3S)-3-carbamoylcyclohexyl]carbamic acid.
| Compound Name | [(1S,3S)-3-carbamoylcyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 68629698 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | [(1S,3S)-3-carbamoylcyclohexyl]carbamic acid |
| SMILES | NC(=O)[C@H]1CCC[C@H](NC(=O)O)C1 |
| InChI | InChI=1S/C8H14N2O3/c9-7(11)5-2-1-3-6(4-5)10-8(12)13/h5-6,10H,1-4H2,(H2,9,11)(H,12,13)/t5-,6-/m0/s1 |
| InChIKey | LBRAHBGPIPZWMU-WDSKDSINSA-N |
| XLogP | 0.30 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |