C10H15F3N2O2 — CID 136527089
3-(3,3,3-trifluoropropanoylamino)cyclohexane-1-carboxamide (PubChem CID 136527089) has the molecular formula C10H15F3N2O2 and a molecular weight of 252.24 g/mol. Its IUPAC name is 3-(3,3,3-trifluoropropanoylamino)cyclohexane-1-carboxamide.
| Compound Name | 3-(3,3,3-trifluoropropanoylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 136527089 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 3-(3,3,3-trifluoropropanoylamino)cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCCC(NC(=O)CC(F)(F)F)C1 |
| InChI | InChI=1S/C10H15F3N2O2/c11-10(12,13)5-8(16)15-7-3-1-2-6(4-7)9(14)17/h6-7H,1-5H2,(H2,14,17)(H,15,16) |
| InChIKey | LHTLXBZBZNLRTL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |