C14H17F3N2OS — CID 102781102
2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-5-(trifluoromethyl)benzenecarbothioamide (PubChem CID 102781102) has the molecular formula C14H17F3N2OS and a molecular weight of 318.36 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-5-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-5-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 102781102 |
| Molecular Formula | C14H17F3N2OS |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-5-(trifluoromethyl)benzenecarbothioamide |
| SMILES | CC1CCN(c2ccc(C(F)(F)F)cc2C(N)=S)C1CO |
| InChI | InChI=1S/C14H17F3N2OS/c1-8-4-5-19(12(8)7-20)11-3-2-9(14(15,16)17)6-10(11)13(18)21/h2-3,6,8,12,20H,4-5,7H2,1H3,(H2,18,21) |
| InChIKey | VSFXTDMAAJOEQU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|